About 2-methylpropyl (2-phenylphenyl) carbonate
2-methylpropyl (2-phenylphenyl) carbonate (PubChem CID 6429240) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-methylpropyl (2-phenylphenyl) carbonate.
Molecular Properties
| Compound Name | 2-methylpropyl (2-phenylphenyl) carbonate |
| PubChem CID | 6429240 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-methylpropyl (2-phenylphenyl) carbonate |
| SMILES | CC(C)COC(=O)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H18O3/c1-13(2)12-19-17(18)20-16-11-7-6-10-15(16)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | QWFZNDGQWHEJIV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl (2-phenylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (2-phenylphenyl) carbonate?
The IUPAC name of 2-methylpropyl (2-phenylphenyl) carbonate (CID 6429240) is 2-methylpropyl (2-phenylphenyl) carbonate.
What is the SMILES notation for 2-methylpropyl (2-phenylphenyl) carbonate?
The canonical SMILES for 2-methylpropyl (2-phenylphenyl) carbonate is CC(C)COC(=O)Oc1ccccc1-c1ccccc1.
What is the InChIKey of 2-methylpropyl (2-phenylphenyl) carbonate?
The InChIKey is QWFZNDGQWHEJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c1-13(2)12-19-17(18)20-16-11-7-6-10-15(16)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3.
What are the key properties of 2-methylpropyl (2-phenylphenyl) carbonate?
2-methylpropyl (2-phenylphenyl) carbonate has a molecular weight of 270.33 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (2-phenylphenyl) carbonate is sourced from PubChem (CID 6429240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).