C15H23NO4 — CID 6429355
[(7R)-7-acetyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl 2-methylbutanoate (PubChem CID 6429355) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is [(7R)-7-acetyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl 2-methylbutanoate.
| Compound Name | [(7R)-7-acetyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 6429355 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [(7R)-7-acetyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1=CCN2CC[C@@H](OC(C)=O)C12 |
| InChI | InChI=1S/C15H23NO4/c1-4-10(2)15(18)19-9-12-5-7-16-8-6-13(14(12)16)20-11(3)17/h5,10,13-14H,4,6-9H2,1-3H3/t10?,13-,14?/m1/s1 |
| InChIKey | TXLFMEAPKXAGPH-IWXRYERYSA-N |
| XLogP | 1.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|