C15H18O4 — CID 642939
(3aR,4R,6S,6aR,9aR,9bR)-4-hydroxy-9-methyl-3-methylidenespiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one (PubChem CID 642939) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3aR,4R,6S,6aR,9aR,9bR)-4-hydroxy-9-methyl-3-methylidenespiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one.
| Compound Name | (3aR,4R,6S,6aR,9aR,9bR)-4-hydroxy-9-methyl-3-methylidenespiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 642939 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3aR,4R,6S,6aR,9aR,9bR)-4-hydroxy-9-methyl-3-methylidenespiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CC[C@H]3[C@]3(CO3)C[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C15H18O4/c1-7-3-4-9-11(7)13-12(8(2)14(17)19-13)10(16)5-15(9)6-18-15/h3,9-13,16H,2,4-6H2,1H3/t9-,10-,11+,12-,13-,15-/m1/s1 |
| InChIKey | RXMQLZQSIOVSTQ-VZGVWICMSA-N |
| XLogP | 1.20 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|