C10H18 — CID 6429433
(1S,2S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane (PubChem CID 6429433) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (1S,2S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane.
| Compound Name | (1S,2S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 6429433 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (1S,2S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane |
| SMILES | C[C@H]1CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C10H18/c1-7-4-5-8-6-9(7)10(8,2)3/h7-9H,4-6H2,1-3H3/t7-,8-,9-/m0/s1 |
| InChIKey | XOKSLPVRUOBDEW-CIUDSAMLSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |