C18H49NO8Si8 — CID 6429713
3-(2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-pentadecamethyl-1,3,5,7,9,11,13,15-octaoxa-2,4,6,8,10,12,14,16-octasilacyclohexadec-2-yl)propanenitrile (PubChem CID 6429713) has the molecular formula C18H49NO8Si8 and a molecular weight of 632.28 g/mol. Its IUPAC name is 3-(2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-pentadecamethyl-1,3,5,7,9,11,13,15-octaoxa-2,4,6,8,10,12,14,16-octasilacyclohexadec-2-yl)propanenitrile.
| Compound Name | 3-(2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-pentadecamethyl-1,3,5,7,9,11,13,15-octaoxa-2,4,6,8,10,12,14,16-octasilacyclohexadec-2-yl)propanenitrile |
|---|---|
| PubChem CID | 6429713 |
| Molecular Formula | C18H49NO8Si8 |
| Molecular Weight | 632.28 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 3-(2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-pentadecamethyl-1,3,5,7,9,11,13,15-octaoxa-2,4,6,8,10,12,14,16-octasilacyclohexadec-2-yl)propanenitrile |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(CCC#N)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C18H49NO8Si8/c1-28(2)20-29(3,4)22-31(7,8)24-33(11,12)26-35(15,18-16-17-19)27-34(13,14)25-32(9,10)23-30(5,6)21-28/h16,18H2,1-15H3 |
| InChIKey | LZDBXFNOXHTKMW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.28 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|