C32H44O6Si6 — CID 6429723
2,2,4,4,6,6,8,8-octamethyl-10,10,12,12-tetraphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 6429723) has the molecular formula C32H44O6Si6 and a molecular weight of 693.21 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octamethyl-10,10,12,12-tetraphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,2,4,4,6,6,8,8-octamethyl-10,10,12,12-tetraphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 6429723 |
| Molecular Formula | C32H44O6Si6 |
| Molecular Weight | 693.21 g/mol |
| Exact Mass | 692.18 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octamethyl-10,10,12,12-tetraphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C32H44O6Si6/c1-39(2)33-40(3,4)35-42(7,8)37-44(31-25-17-11-18-26-31,32-27-19-12-20-28-32)38-43(36-41(5,6)34-39,29-21-13-9-14-22-29)30-23-15-10-16-24-30/h9-28H,1-8H3 |
| InChIKey | AJWGXDFZHTUSPR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.21 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|