C30H38O5Si5 — CID 6429726
2,2,4,4,6,6-hexamethyl-8,8,10,10-tetraphenyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 6429726) has the molecular formula C30H38O5Si5 and a molecular weight of 619.06 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-8,8,10,10-tetraphenyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,4,6,6-hexamethyl-8,8,10,10-tetraphenyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 6429726 |
| Molecular Formula | C30H38O5Si5 |
| Molecular Weight | 619.06 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-8,8,10,10-tetraphenyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C30H38O5Si5/c1-36(2)31-37(3,4)33-39(27-19-11-7-12-20-27,28-21-13-8-14-22-28)35-40(34-38(5,6)32-36,29-23-15-9-16-24-29)30-25-17-10-18-26-30/h7-26H,1-6H3 |
| InChIKey | UKSITUGEFSENNQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.06 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|