C26H45FO3Si2 — CID 6429901
(9R,17S)-9-fluoro-10,13,17-trimethyl-3,17-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-ol (PubChem CID 6429901) has the molecular formula C26H45FO3Si2 and a molecular weight of 480.81 g/mol. Its IUPAC name is (9R,17S)-9-fluoro-10,13,17-trimethyl-3,17-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | (9R,17S)-9-fluoro-10,13,17-trimethyl-3,17-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 6429901 |
| Molecular Formula | C26H45FO3Si2 |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (9R,17S)-9-fluoro-10,13,17-trimethyl-3,17-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-11-ol |
| SMILES | CC12CCC(O[Si](C)(C)C)=CC1=CCC1C3CC[C@](C)(O[Si](C)(C)C)C3(C)CC(O)[C@@]12F |
| InChI | InChI=1S/C26H45FO3Si2/c1-23-14-12-19(29-31(4,5)6)16-18(23)10-11-21-20-13-15-25(3,30-32(7,8)9)24(20,2)17-22(28)26(21,23)27/h10,16,20-22,28H,11-15,17H2,1-9H3/t20?,21?,22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | LMVRJTOISYYBGX-ZKTXFCCKSA-N |
| XLogP | 6.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|