C13H34O4Si3 — CID 6430530
(2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-ol (PubChem CID 6430530) has the molecular formula C13H34O4Si3 and a molecular weight of 338.67 g/mol. Its IUPAC name is (2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-ol.
| Compound Name | (2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-ol |
|---|---|
| PubChem CID | 6430530 |
| Molecular Formula | C13H34O4Si3 |
| Molecular Weight | 338.67 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-ol |
| SMILES | C[Si](C)(C)OC[C@@H](O)[C@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H34O4Si3/c1-18(2,3)15-10-12(14)13(17-20(7,8)9)11-16-19(4,5)6/h12-14H,10-11H2,1-9H3/t12-,13+/m1/s1 |
| InChIKey | OJDFVLFGJAOEBA-OLZOCXBDSA-N |
| XLogP | 3.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|