About 2,3-diacetyloxypropyl (E)-octadec-9-enoate
2,3-diacetyloxypropyl (E)-octadec-9-enoate (PubChem CID 6430588) has the molecular formula C25H44O6
and a molecular weight of 440.62 g/mol. Its IUPAC name is 2,3-diacetyloxypropyl (E)-octadec-9-enoate.
Molecular Properties
| Compound Name | 2,3-diacetyloxypropyl (E)-octadec-9-enoate |
| PubChem CID | 6430588 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 2,3-diacetyloxypropyl (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H44O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)30-21-24(31-23(3)27)20-29-22(2)26/h11-12,24H,4-10,13-21H2,1-3H3/b12-11+ |
| InChIKey | KXLSJQTXSAYFDL-VAWYXSNFSA-N |
| XLogP | 6.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diacetyloxypropyl (E)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diacetyloxypropyl (E)-octadec-9-enoate?
The IUPAC name of 2,3-diacetyloxypropyl (E)-octadec-9-enoate (CID 6430588) is 2,3-diacetyloxypropyl (E)-octadec-9-enoate.
What is the SMILES notation for 2,3-diacetyloxypropyl (E)-octadec-9-enoate?
The canonical SMILES for 2,3-diacetyloxypropyl (E)-octadec-9-enoate is CCCCCCCC/C=C/CCCCCCCC(=O)OCC(COC(C)=O)OC(C)=O.
What is the InChIKey of 2,3-diacetyloxypropyl (E)-octadec-9-enoate?
The InChIKey is KXLSJQTXSAYFDL-VAWYXSNFSA-N. The full InChI is InChI=1S/C25H44O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)30-21-24(31-23(3)27)20-29-22(2)26/h11-12,24H,4-10,13-21H2,1-3H3/b12-11+.
What are the key properties of 2,3-diacetyloxypropyl (E)-octadec-9-enoate?
2,3-diacetyloxypropyl (E)-octadec-9-enoate has a molecular weight of 440.62 g/mol, XLogP of 6.06, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diacetyloxypropyl (E)-octadec-9-enoate is sourced from PubChem (CID 6430588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).