About 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene
2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 6430778) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| PubChem CID | 6430778 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | CC1(C)C2CC=C(COO)C1C2 |
| InChI | InChI=1S/C10H16O2/c1-10(2)8-4-3-7(6-12-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3 |
| InChIKey | WTHZUPXTUUVVBK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The IUPAC name of 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (CID 6430778) is 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
What is the SMILES notation for 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The canonical SMILES for 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is CC1(C)C2CC=C(COO)C1C2.
What is the InChIKey of 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The InChIKey is WTHZUPXTUUVVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-10(2)8-4-3-7(6-12-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3.
What are the key properties of 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene has a molecular weight of 168.24 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroperoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is sourced from PubChem (CID 6430778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).