About 3-ethyl-6-methoxy-2,4-dimethylpyridine
3-ethyl-6-methoxy-2,4-dimethylpyridine (PubChem CID 6430781) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-2,4-dimethylpyridine.
Molecular Properties
| Compound Name | 3-ethyl-6-methoxy-2,4-dimethylpyridine |
| PubChem CID | 6430781 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-ethyl-6-methoxy-2,4-dimethylpyridine |
| SMILES | CCc1c(C)cc(OC)nc1C |
| InChI | InChI=1S/C10H15NO/c1-5-9-7(2)6-10(12-4)11-8(9)3/h6H,5H2,1-4H3 |
| InChIKey | HUINGBHTGJYVMZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-6-methoxy-2,4-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-methoxy-2,4-dimethylpyridine?
The IUPAC name of 3-ethyl-6-methoxy-2,4-dimethylpyridine (CID 6430781) is 3-ethyl-6-methoxy-2,4-dimethylpyridine.
What is the SMILES notation for 3-ethyl-6-methoxy-2,4-dimethylpyridine?
The canonical SMILES for 3-ethyl-6-methoxy-2,4-dimethylpyridine is CCc1c(C)cc(OC)nc1C.
What is the InChIKey of 3-ethyl-6-methoxy-2,4-dimethylpyridine?
The InChIKey is HUINGBHTGJYVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-9-7(2)6-10(12-4)11-8(9)3/h6H,5H2,1-4H3.
What are the key properties of 3-ethyl-6-methoxy-2,4-dimethylpyridine?
3-ethyl-6-methoxy-2,4-dimethylpyridine has a molecular weight of 165.24 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-methoxy-2,4-dimethylpyridine is sourced from PubChem (CID 6430781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).