About (2R)-2-ethenyl-2,6,6-trimethyloxane
(2R)-2-ethenyl-2,6,6-trimethyloxane (PubChem CID 6430803) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (2R)-2-ethenyl-2,6,6-trimethyloxane.
Molecular Properties
| Compound Name | (2R)-2-ethenyl-2,6,6-trimethyloxane |
| PubChem CID | 6430803 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2R)-2-ethenyl-2,6,6-trimethyloxane |
| SMILES | C=C[C@@]1(C)CCCC(C)(C)O1 |
| InChI | InChI=1S/C10H18O/c1-5-10(4)8-6-7-9(2,3)11-10/h5H,1,6-8H2,2-4H3/t10-/m0/s1 |
| InChIKey | NETOHYFTCONTDT-JTQLQIEISA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-ethenyl-2,6,6-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-ethenyl-2,6,6-trimethyloxane?
The IUPAC name of (2R)-2-ethenyl-2,6,6-trimethyloxane (CID 6430803) is (2R)-2-ethenyl-2,6,6-trimethyloxane.
What is the SMILES notation for (2R)-2-ethenyl-2,6,6-trimethyloxane?
The canonical SMILES for (2R)-2-ethenyl-2,6,6-trimethyloxane is C=C[C@@]1(C)CCCC(C)(C)O1.
What is the InChIKey of (2R)-2-ethenyl-2,6,6-trimethyloxane?
The InChIKey is NETOHYFTCONTDT-JTQLQIEISA-N. The full InChI is InChI=1S/C10H18O/c1-5-10(4)8-6-7-9(2,3)11-10/h5H,1,6-8H2,2-4H3/t10-/m0/s1.
What are the key properties of (2R)-2-ethenyl-2,6,6-trimethyloxane?
(2R)-2-ethenyl-2,6,6-trimethyloxane has a molecular weight of 154.25 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethenyl-2,6,6-trimethyloxane is sourced from PubChem (CID 6430803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).