About (Z)-6-methylhept-3-ene
(Z)-6-methylhept-3-ene (PubChem CID 6430919) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is (Z)-6-methylhept-3-ene.
Molecular Properties
| Compound Name | (Z)-6-methylhept-3-ene |
| PubChem CID | 6430919 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | (Z)-6-methylhept-3-ene |
| SMILES | CC/C=C\CC(C)C |
| InChI | InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h5-6,8H,4,7H2,1-3H3/b6-5- |
| InChIKey | PMPISKBGRHSPEE-WAYWQWQTSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-methylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-methylhept-3-ene?
The IUPAC name of (Z)-6-methylhept-3-ene (CID 6430919) is (Z)-6-methylhept-3-ene.
What is the SMILES notation for (Z)-6-methylhept-3-ene?
The canonical SMILES for (Z)-6-methylhept-3-ene is CC/C=C\CC(C)C.
What is the InChIKey of (Z)-6-methylhept-3-ene?
The InChIKey is PMPISKBGRHSPEE-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h5-6,8H,4,7H2,1-3H3/b6-5-.
What are the key properties of (Z)-6-methylhept-3-ene?
(Z)-6-methylhept-3-ene has a molecular weight of 112.22 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-methylhept-3-ene is sourced from PubChem (CID 6430919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).