C26H38O7Si — CID 6430955
[2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-1-(3,4,5-trimethoxyphenyl)propoxy]-trimethylsilane (PubChem CID 6430955) has the molecular formula C26H38O7Si and a molecular weight of 490.67 g/mol. Its IUPAC name is [2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-1-(3,4,5-trimethoxyphenyl)propoxy]-trimethylsilane.
| Compound Name | [2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-1-(3,4,5-trimethoxyphenyl)propoxy]-trimethylsilane |
|---|---|
| PubChem CID | 6430955 |
| Molecular Formula | C26H38O7Si |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-1-(3,4,5-trimethoxyphenyl)propoxy]-trimethylsilane |
| SMILES | C=CCc1cc(OC)c(OC(C)C(O[Si](C)(C)C)c2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C26H38O7Si/c1-11-12-18-13-20(27-3)26(21(14-18)28-4)32-17(2)24(33-34(8,9)10)19-15-22(29-5)25(31-7)23(16-19)30-6/h11,13-17,24H,1,12H2,2-10H3 |
| InChIKey | JZSNTQITZDTUON-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|