C10H16O — CID 6430998
(5E)-2,6-dimethylocta-2,5,7-trien-4-ol (PubChem CID 6430998) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (5E)-2,6-dimethylocta-2,5,7-trien-4-ol.
| Compound Name | (5E)-2,6-dimethylocta-2,5,7-trien-4-ol |
|---|---|
| PubChem CID | 6430998 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (5E)-2,6-dimethylocta-2,5,7-trien-4-ol |
| SMILES | C=C/C(C)=C/C(O)C=C(C)C |
| InChI | InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5-7,10-11H,1H2,2-4H3/b9-7+ |
| InChIKey | DUCHBDMNWUYHGL-VQHVLOKHSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|