About bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate
bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate (PubChem CID 6431001) has the molecular formula C12H26O4Si2
and a molecular weight of 290.51 g/mol. Its IUPAC name is bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate |
| PubChem CID | 6431001 |
| Molecular Formula | C12H26O4Si2 |
| Molecular Weight | 290.51 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate |
| SMILES | C[C@H](C(=O)O[Si](C)(C)C)[C@@H](C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C12H26O4Si2/c1-9(11(13)15-17(3,4)5)10(2)12(14)16-18(6,7)8/h9-10H,1-8H3/t9-,10+ |
| InChIKey | LBUHCVHPJFFRSD-AOOOYVTPSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate?
The IUPAC name of bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate (CID 6431001) is bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate.
What is the SMILES notation for bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate?
The canonical SMILES for bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate is C[C@H](C(=O)O[Si](C)(C)C)[C@@H](C)C(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate?
The InChIKey is LBUHCVHPJFFRSD-AOOOYVTPSA-N. The full InChI is InChI=1S/C12H26O4Si2/c1-9(11(13)15-17(3,4)5)10(2)12(14)16-18(6,7)8/h9-10H,1-8H3/t9-,10+.
What are the key properties of bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate?
bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate has a molecular weight of 290.51 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) (2R,3S)-2,3-dimethylbutanedioate is sourced from PubChem (CID 6431001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).