About 1,2,3-trimethoxynaphthalene
1,2,3-trimethoxynaphthalene (PubChem CID 6431118) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is 1,2,3-trimethoxynaphthalene.
Molecular Properties
| Compound Name | 1,2,3-trimethoxynaphthalene |
| PubChem CID | 6431118 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,2,3-trimethoxynaphthalene |
| SMILES | COc1cc2ccccc2c(OC)c1OC |
| InChI | InChI=1S/C13H14O3/c1-14-11-8-9-6-4-5-7-10(9)12(15-2)13(11)16-3/h4-8H,1-3H3 |
| InChIKey | RANYXVFYAIGDFE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-trimethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethoxynaphthalene?
The IUPAC name of 1,2,3-trimethoxynaphthalene (CID 6431118) is 1,2,3-trimethoxynaphthalene.
What is the SMILES notation for 1,2,3-trimethoxynaphthalene?
The canonical SMILES for 1,2,3-trimethoxynaphthalene is COc1cc2ccccc2c(OC)c1OC.
What is the InChIKey of 1,2,3-trimethoxynaphthalene?
The InChIKey is RANYXVFYAIGDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-14-11-8-9-6-4-5-7-10(9)12(15-2)13(11)16-3/h4-8H,1-3H3.
What are the key properties of 1,2,3-trimethoxynaphthalene?
1,2,3-trimethoxynaphthalene has a molecular weight of 218.25 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethoxynaphthalene is sourced from PubChem (CID 6431118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).