C21H52O6Si5 — CID 6431219
trimethyl-[[(2S,3R,4S,5R)-2,3,4-tris(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]methoxy]silane (PubChem CID 6431219) has the molecular formula C21H52O6Si5 and a molecular weight of 541.07 g/mol. Its IUPAC name is trimethyl-[[(2S,3R,4S,5R)-2,3,4-tris(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]methoxy]silane.
| Compound Name | trimethyl-[[(2S,3R,4S,5R)-2,3,4-tris(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 6431219 |
| Molecular Formula | C21H52O6Si5 |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | trimethyl-[[(2S,3R,4S,5R)-2,3,4-tris(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-yl]methoxy]silane |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H52O6Si5/c1-28(2,3)22-16-18-19(25-30(7,8)9)20(26-31(10,11)12)21(24-18,27-32(13,14)15)17-23-29(4,5)6/h18-20H,16-17H2,1-15H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | PLNWQGWZBNJIQM-MHTWAQMVSA-N |
| XLogP | 6.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|