About 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one
2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one (PubChem CID 6431478) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one.
Molecular Properties
| Compound Name | 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one |
| PubChem CID | 6431478 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one |
| SMILES | C=C[C@@]1(C)CC(O)[C@@H](C(C)C(=O)CC=C(C)C)O1 |
| InChI | InChI=1S/C15H24O3/c1-6-15(5)9-13(17)14(18-15)11(4)12(16)8-7-10(2)3/h6-7,11,13-14,17H,1,8-9H2,2-5H3/t11?,13?,14-,15+/m1/s1 |
| InChIKey | WMHAHVRQYWIAOQ-AXVKAWJUSA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one?
The IUPAC name of 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one (CID 6431478) is 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one.
What is the SMILES notation for 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one?
The canonical SMILES for 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one is C=C[C@@]1(C)CC(O)[C@@H](C(C)C(=O)CC=C(C)C)O1.
What is the InChIKey of 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one?
The InChIKey is WMHAHVRQYWIAOQ-AXVKAWJUSA-N. The full InChI is InChI=1S/C15H24O3/c1-6-15(5)9-13(17)14(18-15)11(4)12(16)8-7-10(2)3/h6-7,11,13-14,17H,1,8-9H2,2-5H3/t11?,13?,14-,15+/m1/s1.
What are the key properties of 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one?
2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one has a molecular weight of 252.35 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,5R)-5-ethenyl-3-hydroxy-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one is sourced from PubChem (CID 6431478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).