About 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one
3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one (PubChem CID 6431481) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one.
Molecular Properties
| Compound Name | 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one |
| PubChem CID | 6431481 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one |
| SMILES | C=C[C@@]1(C)CC[C@@H](C(C)C(C)=O)O1 |
| InChI | InChI=1S/C11H18O2/c1-5-11(4)7-6-10(13-11)8(2)9(3)12/h5,8,10H,1,6-7H2,2-4H3/t8?,10-,11-/m0/s1 |
| InChIKey | RNEVZQGFNUZDJC-CSUXEGHOSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one?
The IUPAC name of 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one (CID 6431481) is 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one.
What is the SMILES notation for 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one?
The canonical SMILES for 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one is C=C[C@@]1(C)CC[C@@H](C(C)C(C)=O)O1.
What is the InChIKey of 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one?
The InChIKey is RNEVZQGFNUZDJC-CSUXEGHOSA-N. The full InChI is InChI=1S/C11H18O2/c1-5-11(4)7-6-10(13-11)8(2)9(3)12/h5,8,10H,1,6-7H2,2-4H3/t8?,10-,11-/m0/s1.
What are the key properties of 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one?
3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one has a molecular weight of 182.26 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]butan-2-one is sourced from PubChem (CID 6431481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).