About 7-iminocyclohepta-1,3,5-trien-1-amine
7-iminocyclohepta-1,3,5-trien-1-amine (PubChem CID 6432120) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 7-iminocyclohepta-1,3,5-trien-1-amine.
Molecular Properties
| Compound Name | 7-iminocyclohepta-1,3,5-trien-1-amine |
| PubChem CID | 6432120 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 7-iminocyclohepta-1,3,5-trien-1-amine |
| SMILES | [H]/N=c1\cccccc1N |
| InChI | InChI=1S/C7H8N2/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H3,8,9) |
| InChIKey | SPGBKYHETUMBKT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-iminocyclohepta-1,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iminocyclohepta-1,3,5-trien-1-amine?
The IUPAC name of 7-iminocyclohepta-1,3,5-trien-1-amine (CID 6432120) is 7-iminocyclohepta-1,3,5-trien-1-amine.
What is the SMILES notation for 7-iminocyclohepta-1,3,5-trien-1-amine?
The canonical SMILES for 7-iminocyclohepta-1,3,5-trien-1-amine is [H]/N=c1\cccccc1N.
What is the InChIKey of 7-iminocyclohepta-1,3,5-trien-1-amine?
The InChIKey is SPGBKYHETUMBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H3,8,9).
What are the key properties of 7-iminocyclohepta-1,3,5-trien-1-amine?
7-iminocyclohepta-1,3,5-trien-1-amine has a molecular weight of 120.15 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iminocyclohepta-1,3,5-trien-1-amine is sourced from PubChem (CID 6432120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).