C14H22N2O2 — CID 6432175
3-[3-(2-cyanoethoxy)-2,2,4,4-tetramethylcyclobutyl]oxypropanenitrile (PubChem CID 6432175) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-[3-(2-cyanoethoxy)-2,2,4,4-tetramethylcyclobutyl]oxypropanenitrile.
| Compound Name | 3-[3-(2-cyanoethoxy)-2,2,4,4-tetramethylcyclobutyl]oxypropanenitrile |
|---|---|
| PubChem CID | 6432175 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-[3-(2-cyanoethoxy)-2,2,4,4-tetramethylcyclobutyl]oxypropanenitrile |
| SMILES | CC1(C)C(OCCC#N)C(C)(C)C1OCCC#N |
| InChI | InChI=1S/C14H22N2O2/c1-13(2)11(17-9-5-7-15)14(3,4)12(13)18-10-6-8-16/h11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | PNKHZYPFJHQBFC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|