C16H42O4Si4 — CID 6432199
trimethyl-[(2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-yl]oxysilane (PubChem CID 6432199) has the molecular formula C16H42O4Si4 and a molecular weight of 410.85 g/mol. Its IUPAC name is trimethyl-[(2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-yl]oxysilane.
| Compound Name | trimethyl-[(2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-yl]oxysilane |
|---|---|
| PubChem CID | 6432199 |
| Molecular Formula | C16H42O4Si4 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | trimethyl-[(2R,3S)-1,3,4-tris(trimethylsilyloxy)butan-2-yl]oxysilane |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H42O4Si4/c1-21(2,3)17-13-15(19-23(7,8)9)16(20-24(10,11)12)14-18-22(4,5)6/h15-16H,13-14H2,1-12H3/t15-,16+ |
| InChIKey | ZBFVOPVQUXWTHM-IYBDPMFKSA-N |
| XLogP | 5.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|