About (2R,3R)-2,3-dimethyloxirane
(2R,3R)-2,3-dimethyloxirane (PubChem CID 6432237) has the molecular formula C4H8O
and a molecular weight of 72.11 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethyloxirane.
Molecular Properties
| Compound Name | (2R,3R)-2,3-dimethyloxirane |
| PubChem CID | 6432237 |
| Molecular Formula | C4H8O |
| Molecular Weight | 72.11 g/mol |
| Exact Mass | 72.06 |
| IUPAC Name | (2R,3R)-2,3-dimethyloxirane |
| SMILES | C[C@H]1O[C@@H]1C |
| InChI | InChI=1S/C4H8O/c1-3-4(2)5-3/h3-4H,1-2H3/t3-,4-/m1/s1 |
| InChIKey | PQXKWPLDPFFDJP-QWWZWVQMSA-N |
| XLogP | 0.79 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.11 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,3-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-dimethyloxirane?
The IUPAC name of (2R,3R)-2,3-dimethyloxirane (CID 6432237) is (2R,3R)-2,3-dimethyloxirane.
What is the SMILES notation for (2R,3R)-2,3-dimethyloxirane?
The canonical SMILES for (2R,3R)-2,3-dimethyloxirane is C[C@H]1O[C@@H]1C.
What is the InChIKey of (2R,3R)-2,3-dimethyloxirane?
The InChIKey is PQXKWPLDPFFDJP-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H8O/c1-3-4(2)5-3/h3-4H,1-2H3/t3-,4-/m1/s1.
What are the key properties of (2R,3R)-2,3-dimethyloxirane?
(2R,3R)-2,3-dimethyloxirane has a molecular weight of 72.11 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-dimethyloxirane is sourced from PubChem (CID 6432237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).