About (2S,4R)-2,4-dimethyloxolane
(2S,4R)-2,4-dimethyloxolane (PubChem CID 6432406) has the molecular formula C6H12O
and a molecular weight of 100.16 g/mol. Its IUPAC name is (2S,4R)-2,4-dimethyloxolane.
Molecular Properties
| Compound Name | (2S,4R)-2,4-dimethyloxolane |
| PubChem CID | 6432406 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | (2S,4R)-2,4-dimethyloxolane |
| SMILES | C[C@H]1CO[C@@H](C)C1 |
| InChI | InChI=1S/C6H12O/c1-5-3-6(2)7-4-5/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | QMGLMRPHOITLSN-RITPCOANSA-N |
| XLogP | 1.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,4R)-2,4-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2,4-dimethyloxolane?
The IUPAC name of (2S,4R)-2,4-dimethyloxolane (CID 6432406) is (2S,4R)-2,4-dimethyloxolane.
What is the SMILES notation for (2S,4R)-2,4-dimethyloxolane?
The canonical SMILES for (2S,4R)-2,4-dimethyloxolane is C[C@H]1CO[C@@H](C)C1.
What is the InChIKey of (2S,4R)-2,4-dimethyloxolane?
The InChIKey is QMGLMRPHOITLSN-RITPCOANSA-N. The full InChI is InChI=1S/C6H12O/c1-5-3-6(2)7-4-5/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1.
What are the key properties of (2S,4R)-2,4-dimethyloxolane?
(2S,4R)-2,4-dimethyloxolane has a molecular weight of 100.16 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-dimethyloxolane is sourced from PubChem (CID 6432406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).