About (2R,3S)-2,3-dichlorobutane
(2R,3S)-2,3-dichlorobutane (PubChem CID 6432415) has the molecular formula C4H8Cl2
and a molecular weight of 127.01 g/mol. Its IUPAC name is (2R,3S)-2,3-dichlorobutane.
Molecular Properties
| Compound Name | (2R,3S)-2,3-dichlorobutane |
| PubChem CID | 6432415 |
| Molecular Formula | C4H8Cl2 |
| Molecular Weight | 127.01 g/mol |
| Exact Mass | 126.00 |
| IUPAC Name | (2R,3S)-2,3-dichlorobutane |
| SMILES | C[C@H](Cl)[C@@H](C)Cl |
| InChI | InChI=1S/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4+ |
| InChIKey | RMISVOPUIFJTEO-ZXZARUISSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.01 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2,3-dichlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2,3-dichlorobutane?
The IUPAC name of (2R,3S)-2,3-dichlorobutane (CID 6432415) is (2R,3S)-2,3-dichlorobutane.
What is the SMILES notation for (2R,3S)-2,3-dichlorobutane?
The canonical SMILES for (2R,3S)-2,3-dichlorobutane is C[C@H](Cl)[C@@H](C)Cl.
What is the InChIKey of (2R,3S)-2,3-dichlorobutane?
The InChIKey is RMISVOPUIFJTEO-ZXZARUISSA-N. The full InChI is InChI=1S/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4+.
What are the key properties of (2R,3S)-2,3-dichlorobutane?
(2R,3S)-2,3-dichlorobutane has a molecular weight of 127.01 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,3-dichlorobutane is sourced from PubChem (CID 6432415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).