C10H20 — CID 6432486
cis-(3R,5S)-1,1,3,5-tetramethylcyclohexane (PubChem CID 6432486) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is cis-(3R,5S)-1,1,3,5-tetramethylcyclohexane.
| Compound Name | cis-(3R,5S)-1,1,3,5-tetramethylcyclohexane |
|---|---|
| PubChem CID | 6432486 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | cis-(3R,5S)-1,1,3,5-tetramethylcyclohexane |
| SMILES | C[C@@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C10H20/c1-8-5-9(2)7-10(3,4)6-8/h8-9H,5-7H2,1-4H3/t8-,9+ |
| InChIKey | WOJSMJIXPQLESQ-DTORHVGOSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |