About diazanium;phthalate
diazanium;phthalate (PubChem CID 6432521) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is diazanium;phthalate.
Molecular Properties
| Compound Name | diazanium;phthalate |
| PubChem CID | 6432521 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | diazanium;phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C8H6O4.2H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);2*1H3 |
| InChIKey | CHCFOMQHQIQBLZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diazanium;phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;phthalate?
The IUPAC name of diazanium;phthalate (CID 6432521) is diazanium;phthalate.
What is the SMILES notation for diazanium;phthalate?
The canonical SMILES for diazanium;phthalate is O=C([O-])c1ccccc1C(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;phthalate?
The InChIKey is CHCFOMQHQIQBLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);2*1H3.
What are the key properties of diazanium;phthalate?
diazanium;phthalate has a molecular weight of 200.19 g/mol, XLogP of -0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;phthalate is sourced from PubChem (CID 6432521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).