About 2-methanidylpropane
2-methanidylpropane (PubChem CID 6432624) has the molecular formula C4H9-
and a molecular weight of 57.12 g/mol. Its IUPAC name is 2-methanidylpropane.
Molecular Properties
| Compound Name | 2-methanidylpropane |
| PubChem CID | 6432624 |
| Molecular Formula | C4H9- |
| Molecular Weight | 57.12 g/mol |
| Exact Mass | 57.07 |
| IUPAC Name | 2-methanidylpropane |
| SMILES | [CH2-]C(C)C |
| InChI | InChI=1S/C4H9/c1-4(2)3/h4H,1H2,2-3H3/q-1 |
| InChIKey | RFONJRMUUALMBA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 57.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylpropane?
The IUPAC name of 2-methanidylpropane (CID 6432624) is 2-methanidylpropane.
What is the SMILES notation for 2-methanidylpropane?
The canonical SMILES for 2-methanidylpropane is [CH2-]C(C)C.
What is the InChIKey of 2-methanidylpropane?
The InChIKey is RFONJRMUUALMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9/c1-4(2)3/h4H,1H2,2-3H3/q-1.
What are the key properties of 2-methanidylpropane?
2-methanidylpropane has a molecular weight of 57.12 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylpropane is sourced from PubChem (CID 6432624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).