About N'-ethyl-N,N-dimethylmethanimidamide
N'-ethyl-N,N-dimethylmethanimidamide (PubChem CID 6432689) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is N'-ethyl-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-ethyl-N,N-dimethylmethanimidamide |
| PubChem CID | 6432689 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | N'-ethyl-N,N-dimethylmethanimidamide |
| SMILES | CC/N=C/N(C)C |
| InChI | InChI=1S/C5H12N2/c1-4-6-5-7(2)3/h5H,4H2,1-3H3/b6-5+ |
| InChIKey | XXKGMXBJIMBFCS-AATRIKPKSA-N |
| XLogP | 0.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N,N-dimethylmethanimidamide?
The IUPAC name of N'-ethyl-N,N-dimethylmethanimidamide (CID 6432689) is N'-ethyl-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-ethyl-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-ethyl-N,N-dimethylmethanimidamide is CC/N=C/N(C)C.
What is the InChIKey of N'-ethyl-N,N-dimethylmethanimidamide?
The InChIKey is XXKGMXBJIMBFCS-AATRIKPKSA-N. The full InChI is InChI=1S/C5H12N2/c1-4-6-5-7(2)3/h5H,4H2,1-3H3/b6-5+.
What are the key properties of N'-ethyl-N,N-dimethylmethanimidamide?
N'-ethyl-N,N-dimethylmethanimidamide has a molecular weight of 100.16 g/mol, XLogP of 0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N,N-dimethylmethanimidamide is sourced from PubChem (CID 6432689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).