C10H20O5 — CID 6432740
(2S,3R,4R,5S)-3,4,5-trimethoxy-2-(methoxymethyl)oxane (PubChem CID 6432740) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3,4,5-trimethoxy-2-(methoxymethyl)oxane.
| Compound Name | (2S,3R,4R,5S)-3,4,5-trimethoxy-2-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 6432740 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2S,3R,4R,5S)-3,4,5-trimethoxy-2-(methoxymethyl)oxane |
| SMILES | COC[C@@H]1OC[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C10H20O5/c1-11-5-8-10(14-4)9(13-3)7(12-2)6-15-8/h7-10H,5-6H2,1-4H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | SQOPNOVHKFZFPJ-AXTSPUMRSA-N |
| XLogP | 0.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |