About pentan-2-yl 2,2,2-tribromoacetate
pentan-2-yl 2,2,2-tribromoacetate (PubChem CID 6432838) has the molecular formula C7H11Br3O2
and a molecular weight of 366.88 g/mol. Its IUPAC name is pentan-2-yl 2,2,2-tribromoacetate.
Molecular Properties
| Compound Name | pentan-2-yl 2,2,2-tribromoacetate |
| PubChem CID | 6432838 |
| Molecular Formula | C7H11Br3O2 |
| Molecular Weight | 366.88 g/mol |
| Exact Mass | 363.83 |
| IUPAC Name | pentan-2-yl 2,2,2-tribromoacetate |
| SMILES | CCCC(C)OC(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C7H11Br3O2/c1-3-4-5(2)12-6(11)7(8,9)10/h5H,3-4H2,1-2H3 |
| InChIKey | MJLVEJKVDIYJEE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl 2,2,2-tribromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 2,2,2-tribromoacetate?
The IUPAC name of pentan-2-yl 2,2,2-tribromoacetate (CID 6432838) is pentan-2-yl 2,2,2-tribromoacetate.
What is the SMILES notation for pentan-2-yl 2,2,2-tribromoacetate?
The canonical SMILES for pentan-2-yl 2,2,2-tribromoacetate is CCCC(C)OC(=O)C(Br)(Br)Br.
What is the InChIKey of pentan-2-yl 2,2,2-tribromoacetate?
The InChIKey is MJLVEJKVDIYJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Br3O2/c1-3-4-5(2)12-6(11)7(8,9)10/h5H,3-4H2,1-2H3.
What are the key properties of pentan-2-yl 2,2,2-tribromoacetate?
pentan-2-yl 2,2,2-tribromoacetate has a molecular weight of 366.88 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 2,2,2-tribromoacetate is sourced from PubChem (CID 6432838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).