About (4-fluorophenyl) propanoate
(4-fluorophenyl) propanoate (PubChem CID 643284) has the molecular formula C9H9FO2
and a molecular weight of 168.17 g/mol. Its IUPAC name is (4-fluorophenyl) propanoate.
Molecular Properties
| Compound Name | (4-fluorophenyl) propanoate |
| PubChem CID | 643284 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (4-fluorophenyl) propanoate |
| SMILES | CCC(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FO2/c1-2-9(11)12-8-5-3-7(10)4-6-8/h3-6H,2H2,1H3 |
| InChIKey | RWEKFYQVRRXQJZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) propanoate?
The IUPAC name of (4-fluorophenyl) propanoate (CID 643284) is (4-fluorophenyl) propanoate.
What is the SMILES notation for (4-fluorophenyl) propanoate?
The canonical SMILES for (4-fluorophenyl) propanoate is CCC(=O)Oc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl) propanoate?
The InChIKey is RWEKFYQVRRXQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO2/c1-2-9(11)12-8-5-3-7(10)4-6-8/h3-6H,2H2,1H3.
What are the key properties of (4-fluorophenyl) propanoate?
(4-fluorophenyl) propanoate has a molecular weight of 168.17 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) propanoate is sourced from PubChem (CID 643284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).