C15H26O — CID 6432846
(4E)-3,3,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-ene (PubChem CID 6432846) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (4E)-3,3,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-ene.
| Compound Name | (4E)-3,3,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-ene |
|---|---|
| PubChem CID | 6432846 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (4E)-3,3,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-ene |
| SMILES | CC1C/C=C/C(C)(C)CC2OC2(C)CCC1 |
| InChI | InChI=1S/C15H26O/c1-12-7-5-9-14(2,3)11-13-15(4,16-13)10-6-8-12/h5,9,12-13H,6-8,10-11H2,1-4H3/b9-5+ |
| InChIKey | MNJMQINRKGQYTP-WEVVVXLNSA-N |
| XLogP | 4.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|