About ethyl 5-hydroxyoctanoate
ethyl 5-hydroxyoctanoate (PubChem CID 6432923) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is ethyl 5-hydroxyoctanoate.
Molecular Properties
| Compound Name | ethyl 5-hydroxyoctanoate |
| PubChem CID | 6432923 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | ethyl 5-hydroxyoctanoate |
| SMILES | CCCC(O)CCCC(=O)OCC |
| InChI | InChI=1S/C10H20O3/c1-3-6-9(11)7-5-8-10(12)13-4-2/h9,11H,3-8H2,1-2H3 |
| InChIKey | GIFGDAGRKYHDLN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxyoctanoate?
The IUPAC name of ethyl 5-hydroxyoctanoate (CID 6432923) is ethyl 5-hydroxyoctanoate.
What is the SMILES notation for ethyl 5-hydroxyoctanoate?
The canonical SMILES for ethyl 5-hydroxyoctanoate is CCCC(O)CCCC(=O)OCC.
What is the InChIKey of ethyl 5-hydroxyoctanoate?
The InChIKey is GIFGDAGRKYHDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-3-6-9(11)7-5-8-10(12)13-4-2/h9,11H,3-8H2,1-2H3.
What are the key properties of ethyl 5-hydroxyoctanoate?
ethyl 5-hydroxyoctanoate has a molecular weight of 188.27 g/mol, XLogP of 1.88, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxyoctanoate is sourced from PubChem (CID 6432923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).