C21H40O10S2 — CID 6433044
2,3-disulfooxypropyl (Z)-octadec-9-enoate (PubChem CID 6433044) has the molecular formula C21H40O10S2 and a molecular weight of 516.68 g/mol. Its IUPAC name is 2,3-disulfooxypropyl (Z)-octadec-9-enoate.
| Compound Name | 2,3-disulfooxypropyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 6433044 |
| Molecular Formula | C21H40O10S2 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2,3-disulfooxypropyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COS(=O)(=O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C21H40O10S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(22)29-18-20(31-33(26,27)28)19-30-32(23,24)25/h9-10,20H,2-8,11-19H2,1H3,(H,23,24,25)(H,26,27,28)/b10-9- |
| InChIKey | NPRMOGCTZRQUFS-KTKRTIGZSA-N |
| XLogP | 4.57 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|