About bicyclo[3.3.1]nonane-3,7-dione
bicyclo[3.3.1]nonane-3,7-dione (PubChem CID 643315) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is bicyclo[3.3.1]nonane-3,7-dione.
Molecular Properties
| Compound Name | bicyclo[3.3.1]nonane-3,7-dione |
| PubChem CID | 643315 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | bicyclo[3.3.1]nonane-3,7-dione |
| SMILES | O=C1CC2CC(=O)CC(C1)C2 |
| InChI | InChI=1S/C9H12O2/c10-8-2-6-1-7(4-8)5-9(11)3-6/h6-7H,1-5H2 |
| InChIKey | KIKCULSOJJAIEB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bicyclo[3.3.1]nonane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.3.1]nonane-3,7-dione?
The IUPAC name of bicyclo[3.3.1]nonane-3,7-dione (CID 643315) is bicyclo[3.3.1]nonane-3,7-dione.
What is the SMILES notation for bicyclo[3.3.1]nonane-3,7-dione?
The canonical SMILES for bicyclo[3.3.1]nonane-3,7-dione is O=C1CC2CC(=O)CC(C1)C2.
What is the InChIKey of bicyclo[3.3.1]nonane-3,7-dione?
The InChIKey is KIKCULSOJJAIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c10-8-2-6-1-7(4-8)5-9(11)3-6/h6-7H,1-5H2.
What are the key properties of bicyclo[3.3.1]nonane-3,7-dione?
bicyclo[3.3.1]nonane-3,7-dione has a molecular weight of 152.19 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.3.1]nonane-3,7-dione is sourced from PubChem (CID 643315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).