About (5E)-3,4-dimethyl-5-pentylidenefuran-2-one
(5E)-3,4-dimethyl-5-pentylidenefuran-2-one (PubChem CID 6433214) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (5E)-3,4-dimethyl-5-pentylidenefuran-2-one.
Molecular Properties
| Compound Name | (5E)-3,4-dimethyl-5-pentylidenefuran-2-one |
| PubChem CID | 6433214 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (5E)-3,4-dimethyl-5-pentylidenefuran-2-one |
| SMILES | CCCC/C=C1/OC(=O)C(C)=C1C |
| InChI | InChI=1S/C11H16O2/c1-4-5-6-7-10-8(2)9(3)11(12)13-10/h7H,4-6H2,1-3H3/b10-7+ |
| InChIKey | MTQPZHNZYWAXEH-JXMROGBWSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3,4-dimethyl-5-pentylidenefuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3,4-dimethyl-5-pentylidenefuran-2-one?
The IUPAC name of (5E)-3,4-dimethyl-5-pentylidenefuran-2-one (CID 6433214) is (5E)-3,4-dimethyl-5-pentylidenefuran-2-one.
What is the SMILES notation for (5E)-3,4-dimethyl-5-pentylidenefuran-2-one?
The canonical SMILES for (5E)-3,4-dimethyl-5-pentylidenefuran-2-one is CCCC/C=C1/OC(=O)C(C)=C1C.
What is the InChIKey of (5E)-3,4-dimethyl-5-pentylidenefuran-2-one?
The InChIKey is MTQPZHNZYWAXEH-JXMROGBWSA-N. The full InChI is InChI=1S/C11H16O2/c1-4-5-6-7-10-8(2)9(3)11(12)13-10/h7H,4-6H2,1-3H3/b10-7+.
What are the key properties of (5E)-3,4-dimethyl-5-pentylidenefuran-2-one?
(5E)-3,4-dimethyl-5-pentylidenefuran-2-one has a molecular weight of 180.25 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3,4-dimethyl-5-pentylidenefuran-2-one is sourced from PubChem (CID 6433214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).