C21H25N3O4 — CID 6433327
2-(6,11-dihydrobenzo[b][1,4]benzodiazepin-5-yl)ethyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6433327) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(6,11-dihydrobenzo[b][1,4]benzodiazepin-5-yl)ethyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 2-(6,11-dihydrobenzo[b][1,4]benzodiazepin-5-yl)ethyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6433327 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(6,11-dihydrobenzo[b][1,4]benzodiazepin-5-yl)ethyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[NH+](C)CCN1Cc2ccccc2Nc2ccccc21.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C17H21N3.C4H4O4/c1-19(2)11-12-20-13-14-7-3-4-8-15(14)18-16-9-5-6-10-17(16)20;5-3(6)1-2-4(7)8/h3-10,18H,11-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GJTWVSHRUYJFEB-BTJKTKAUSA-N |
| XLogP | 0.27 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|