C20H35NO3 — CID 6433346
2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid (PubChem CID 6433346) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid.
| Compound Name | 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid |
|---|---|
| PubChem CID | 6433346 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C20H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h6-7,9-10H,2-5,8,11-18H2,1H3,(H,21,22)(H,23,24)/b7-6-,10-9- |
| InChIKey | YCRHZEHWEYAHCO-HZJYTTRNSA-N |
| XLogP | 5.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|