2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid

C20H35NO3 — CID 6433346

IUPAC2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCC(=O)NCC(=O)O
InChIInChI=1S/C20H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h6-7,9-10H,2-5,8,11-18H2,1H3,(H,21,22)(H,23,24)/b7-6-,10-9-
InChIKeyYCRHZEHWEYAHCO-HZJYTTRNSA-N
MW337.50 g/mol
LogP5.00
Rot. Bonds16

About 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid

2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid (PubChem CID 6433346) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid
PubChem CID6433346
Molecular FormulaC20H35NO3
Molecular Weight337.50 g/mol
Exact Mass337.26
IUPAC Name2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCC(=O)NCC(=O)O
InChIInChI=1S/C20H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h6-7,9-10H,2-5,8,11-18H2,1H3,(H,21,22)(H,23,24)/b7-6-,10-9-
InChIKeyYCRHZEHWEYAHCO-HZJYTTRNSA-N
XLogP5.00
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds16
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500337.50
LogP ≤ 55.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid?
The IUPAC name of 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid (CID 6433346) is 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid.
What is the SMILES notation for 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid?
The canonical SMILES for 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid is CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCC(=O)O.
What is the InChIKey of 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid?
The InChIKey is YCRHZEHWEYAHCO-HZJYTTRNSA-N. The full InChI is InChI=1S/C20H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h6-7,9-10H,2-5,8,11-18H2,1H3,(H,21,22)(H,23,24)/b7-6-,10-9-.
What are the key properties of 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid?
2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid has a molecular weight of 337.50 g/mol, XLogP of 5.00, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]acetic acid is sourced from PubChem (CID 6433346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).