C23H28N2O4 — CID 6433362
(E)-but-2-enedioic acid;N-methyl-3-(5-methyl-6,11-dihydrobenzo[c][1]benzazepin-11-yl)propan-1-amine (PubChem CID 6433362) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-methyl-3-(5-methyl-6,11-dihydrobenzo[c][1]benzazepin-11-yl)propan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N-methyl-3-(5-methyl-6,11-dihydrobenzo[c][1]benzazepin-11-yl)propan-1-amine |
|---|---|
| PubChem CID | 6433362 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (E)-but-2-enedioic acid;N-methyl-3-(5-methyl-6,11-dihydrobenzo[c][1]benzazepin-11-yl)propan-1-amine |
| SMILES | CNCCCC1c2ccccc2CN(C)c2ccccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H24N2.C4H4O4/c1-20-13-7-11-17-16-9-4-3-8-15(16)14-21(2)19-12-6-5-10-18(17)19;5-3(6)1-2-4(7)8/h3-6,8-10,12,17,20H,7,11,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | DZSACGCXMKKHKB-WLHGVMLRSA-N |
| XLogP | 3.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|