C23H29ClN2 — CID 6433480
N,N-diethyl-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline chloride (PubChem CID 6433480) has the molecular formula C23H29ClN2 and a molecular weight of 368.95 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline chloride.
| Compound Name | N,N-diethyl-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline chloride |
|---|---|
| PubChem CID | 6433480 |
| Molecular Formula | C23H29ClN2 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N,N-diethyl-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline chloride |
| SMILES | CCN(CC)c1ccc(/C=C/C2=[N+](C)c3ccccc3C2(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C23H29N2.ClH/c1-6-25(7-2)19-15-12-18(13-16-19)14-17-22-23(3,4)20-10-8-9-11-21(20)24(22)5;/h8-17H,6-7H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | PKALEBFTSZCHGU-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|