About dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane
dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane (PubChem CID 6433516) has the molecular formula C6H18O4Si3
and a molecular weight of 238.46 g/mol. Its IUPAC name is dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane |
| PubChem CID | 6433516 |
| Molecular Formula | C6H18O4Si3 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane |
| SMILES | CO[Si](C)(C)O[Si](C)(C)C.O=[Si]=O |
| InChI | InChI=1S/C6H18O2Si2.O2Si/c1-7-10(5,6)8-9(2,3)4;1-3-2/h1-6H3; |
| InChIKey | AMTWCFIAVKBGOD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane?
The IUPAC name of dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane (CID 6433516) is dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane.
What is the SMILES notation for dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane?
The canonical SMILES for dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane is CO[Si](C)(C)O[Si](C)(C)C.O=[Si]=O.
What is the InChIKey of dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane?
The InChIKey is AMTWCFIAVKBGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18O2Si2.O2Si/c1-7-10(5,6)8-9(2,3)4;1-3-2/h1-6H3;.
What are the key properties of dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane?
dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane has a molecular weight of 238.46 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane is sourced from PubChem (CID 6433516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).