C23H26N2O7 — CID 6433610
1-(2-benzoylpyrrol-1-yl)-4-morpholin-4-ium-4-ylbutan-2-one;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6433610) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-(2-benzoylpyrrol-1-yl)-4-morpholin-4-ium-4-ylbutan-2-one;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 1-(2-benzoylpyrrol-1-yl)-4-morpholin-4-ium-4-ylbutan-2-one;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6433610 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-(2-benzoylpyrrol-1-yl)-4-morpholin-4-ium-4-ylbutan-2-one;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | O=C(CC[NH+]1CCOCC1)Cn1cccc1C(=O)c1ccccc1.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C19H22N2O3.C4H4O4/c22-17(8-10-20-11-13-24-14-12-20)15-21-9-4-7-18(21)19(23)16-5-2-1-3-6-16;5-3(6)1-2-4(7)8/h1-7,9H,8,10-15H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WBZXBKZFRNMGHF-BTJKTKAUSA-N |
| XLogP | -1.03 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|