About (Z)-4-hydroxynon-2-enal
(Z)-4-hydroxynon-2-enal (PubChem CID 6433714) has the molecular formula C9H16O2
and a molecular weight of 156.23 g/mol. Its IUPAC name is (Z)-4-hydroxynon-2-enal.
Molecular Properties
| Compound Name | (Z)-4-hydroxynon-2-enal |
| PubChem CID | 6433714 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (Z)-4-hydroxynon-2-enal |
| SMILES | CCCCCC(O)/C=C\C=O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-6-9(11)7-5-8-10/h5,7-9,11H,2-4,6H2,1H3/b7-5- |
| InChIKey | JVJFIQYAHPMBBX-ALCCZGGFSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxynon-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxynon-2-enal?
The IUPAC name of (Z)-4-hydroxynon-2-enal (CID 6433714) is (Z)-4-hydroxynon-2-enal.
What is the SMILES notation for (Z)-4-hydroxynon-2-enal?
The canonical SMILES for (Z)-4-hydroxynon-2-enal is CCCCCC(O)/C=C\C=O.
What is the InChIKey of (Z)-4-hydroxynon-2-enal?
The InChIKey is JVJFIQYAHPMBBX-ALCCZGGFSA-N. The full InChI is InChI=1S/C9H16O2/c1-2-3-4-6-9(11)7-5-8-10/h5,7-9,11H,2-4,6H2,1H3/b7-5-.
What are the key properties of (Z)-4-hydroxynon-2-enal?
(Z)-4-hydroxynon-2-enal has a molecular weight of 156.23 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxynon-2-enal is sourced from PubChem (CID 6433714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).