About 2,4,5-trihydroxybenzaldehyde
2,4,5-trihydroxybenzaldehyde (PubChem CID 643387) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is 2,4,5-trihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 2,4,5-trihydroxybenzaldehyde |
| PubChem CID | 643387 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 2,4,5-trihydroxybenzaldehyde |
| SMILES | O=Cc1cc(O)c(O)cc1O |
| InChI | InChI=1S/C7H6O4/c8-3-4-1-6(10)7(11)2-5(4)9/h1-3,9-11H |
| InChIKey | WNCNWLVQSHZVKV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trihydroxybenzaldehyde?
The IUPAC name of 2,4,5-trihydroxybenzaldehyde (CID 643387) is 2,4,5-trihydroxybenzaldehyde.
What is the SMILES notation for 2,4,5-trihydroxybenzaldehyde?
The canonical SMILES for 2,4,5-trihydroxybenzaldehyde is O=Cc1cc(O)c(O)cc1O.
What is the InChIKey of 2,4,5-trihydroxybenzaldehyde?
The InChIKey is WNCNWLVQSHZVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-3-4-1-6(10)7(11)2-5(4)9/h1-3,9-11H.
What are the key properties of 2,4,5-trihydroxybenzaldehyde?
2,4,5-trihydroxybenzaldehyde has a molecular weight of 154.12 g/mol, XLogP of 0.62, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trihydroxybenzaldehyde is sourced from PubChem (CID 643387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).