C23H27NO4Se — CID 6433877
3-(6,11-dihydrobenzo[c][1]benzoselenepin-11-yl)propyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6433877) has the molecular formula C23H27NO4Se and a molecular weight of 460.43 g/mol. Its IUPAC name is 3-(6,11-dihydrobenzo[c][1]benzoselenepin-11-yl)propyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 3-(6,11-dihydrobenzo[c][1]benzoselenepin-11-yl)propyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6433877 |
| Molecular Formula | C23H27NO4Se |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-(6,11-dihydrobenzo[c][1]benzoselenepin-11-yl)propyl-dimethylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[NH+](C)CCCC1c2ccccc2C[Se]c2ccccc21.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C19H23NSe.C4H4O4/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19;5-3(6)1-2-4(7)8/h3-6,8-10,12,17H,7,11,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SFUANLGFINFROE-BTJKTKAUSA-N |
| XLogP | -0.04 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|