C24H48 — CID 6433967
2,5-dimethylhex-1-ene;2,5-dimethylhex-2-ene;(E)-2,5-dimethylhex-3-ene (PubChem CID 6433967) has the molecular formula C24H48 and a molecular weight of 336.65 g/mol. Its IUPAC name is 2,5-dimethylhex-1-ene;2,5-dimethylhex-2-ene;(E)-2,5-dimethylhex-3-ene.
| Compound Name | 2,5-dimethylhex-1-ene;2,5-dimethylhex-2-ene;(E)-2,5-dimethylhex-3-ene |
|---|---|
| PubChem CID | 6433967 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 2,5-dimethylhex-1-ene;2,5-dimethylhex-2-ene;(E)-2,5-dimethylhex-3-ene |
| SMILES | C=C(C)CCC(C)C.CC(C)/C=C/C(C)C.CC(C)=CCC(C)C |
| InChI | InChI=1S/3C8H16/c3*1-7(2)5-6-8(3)4/h5,8H,6H2,1-4H3;5-8H,1-4H3;8H,1,5-6H2,2-4H3/b;6-5+; |
| InChIKey | DJDLBMVKJOTHRT-AUNBPGBOSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|