C20H28ClNO2 — CID 6433996
[(2R,3R,4S)-3-methyl-2-[(1E,3E)-4-phenylbuta-1,3-dienyl]piperidin-1-ium-4-yl] 2-methylpropanoate chloride (PubChem CID 6433996) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is [(2R,3R,4S)-3-methyl-2-[(1E,3E)-4-phenylbuta-1,3-dienyl]piperidin-1-ium-4-yl] 2-methylpropanoate chloride.
| Compound Name | [(2R,3R,4S)-3-methyl-2-[(1E,3E)-4-phenylbuta-1,3-dienyl]piperidin-1-ium-4-yl] 2-methylpropanoate chloride |
|---|---|
| PubChem CID | 6433996 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | [(2R,3R,4S)-3-methyl-2-[(1E,3E)-4-phenylbuta-1,3-dienyl]piperidin-1-ium-4-yl] 2-methylpropanoate chloride |
| SMILES | CC(C)C(=O)O[C@H]1CC[NH2+][C@H](/C=C/C=C/c2ccccc2)[C@H]1C.[Cl-] |
| InChI | InChI=1S/C20H27NO2.ClH/c1-15(2)20(22)23-19-13-14-21-18(16(19)3)12-8-7-11-17-9-5-4-6-10-17;/h4-12,15-16,18-19,21H,13-14H2,1-3H3;1H/b11-7+,12-8+;/t16-,18-,19+;/m1./s1 |
| InChIKey | CCVMKXIKKJBYRX-AKOPKFBKSA-N |
| XLogP | -0.20 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|